C19H26F3N3O5S — CID 166517058
ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclopentyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166517058) has the molecular formula C19H26F3N3O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclopentyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclopentyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166517058 |
| Molecular Formula | C19H26F3N3O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[2-[1-(trifluoromethyl)cyclopentyl]oxyethyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)NC(=S)N(CCOC1(C(F)(F)F)CCCC1)c1cc[nH]c1C(=O)OCC |
| InChI | InChI=1S/C19H26F3N3O5S/c1-3-28-15(26)14-13(7-10-23-14)25(16(31)24-17(27)29-4-2)11-12-30-18(19(20,21)22)8-5-6-9-18/h7,10,23H,3-6,8-9,11-12H2,1-2H3,(H,24,27,31) |
| InChIKey | QEPPMJKVQHPVHO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|