C9H7F14O4P — CID 166519573
2-[2-difluorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane (PubChem CID 166519573) has the molecular formula C9H7F14O4P and a molecular weight of 476.10 g/mol. Its IUPAC name is 2-[2-difluorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane.
| Compound Name | 2-[2-difluorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 166519573 |
| Molecular Formula | C9H7F14O4P |
| Molecular Weight | 476.10 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 2-[2-difluorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane |
| SMILES | O=P(F)(F)OC(COC(C(F)(F)F)C(F)(F)F)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H7F14O4P/c10-6(11,12)4(7(13,14)15)25-1-3(27-28(22,23)24)2-26-5(8(16,17)18)9(19,20)21/h3-5H,1-2H2 |
| InChIKey | DSXLHZBYSMTVPW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.10 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|