C16H21F5N2OS — CID 166520359
1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[3.3]heptan-2-ylurea (PubChem CID 166520359) has the molecular formula C16H21F5N2OS and a molecular weight of 384.41 g/mol. Its IUPAC name is 1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[3.3]heptan-2-ylurea.
| Compound Name | 1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[3.3]heptan-2-ylurea |
|---|---|
| PubChem CID | 166520359 |
| Molecular Formula | C16H21F5N2OS |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[3.3]heptan-2-ylurea |
| SMILES | CC(NC(=O)NC1CC2(CCC2)C1)c1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F5N2OS/c1-11(12-4-2-5-14(8-12)25(17,18,19,20)21)22-15(24)23-13-9-16(10-13)6-3-7-16/h2,4-5,8,11,13H,3,6-7,9-10H2,1H3,(H2,22,23,24) |
| InChIKey | ZMNHCSJBRUYOJE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |