C19H25F3N2O2 — CID 166520249
1-[2-hydroxy-2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-spiro[3.3]heptan-2-ylurea (PubChem CID 166520249) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 1-[2-hydroxy-2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-spiro[3.3]heptan-2-ylurea.
| Compound Name | 1-[2-hydroxy-2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-spiro[3.3]heptan-2-ylurea |
|---|---|
| PubChem CID | 166520249 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[2-hydroxy-2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-spiro[3.3]heptan-2-ylurea |
| SMILES | CC(C)(O)C(NC(=O)NC1CC2(CCC2)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-17(2,26)15(12-5-3-6-13(9-12)19(20,21)22)24-16(25)23-14-10-18(11-14)7-4-8-18/h3,5-6,9,14-15,26H,4,7-8,10-11H2,1-2H3,(H2,23,24,25) |
| InChIKey | TWZSSNLSVNUARQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |