C15H19F5N2OS — CID 166520292
1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[2.3]hexan-5-ylurea (PubChem CID 166520292) has the molecular formula C15H19F5N2OS and a molecular weight of 370.39 g/mol. Its IUPAC name is 1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[2.3]hexan-5-ylurea.
| Compound Name | 1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[2.3]hexan-5-ylurea |
|---|---|
| PubChem CID | 166520292 |
| Molecular Formula | C15H19F5N2OS |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[1-[3-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-spiro[2.3]hexan-5-ylurea |
| SMILES | CC(NC(=O)NC1CC2(CC2)C1)c1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F5N2OS/c1-10(21-14(23)22-12-8-15(9-12)5-6-15)11-3-2-4-13(7-11)24(16,17,18,19)20/h2-4,7,10,12H,5-6,8-9H2,1H3,(H2,21,22,23) |
| InChIKey | TZWVGTFTPOAIMF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |