C18H19F3N2O — CID 166520313
1-spiro[3.3]heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 166520313) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is 1-spiro[3.3]heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-spiro[3.3]heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 166520313 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-spiro[3.3]heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | C#CC(NC(=O)NC1CC2(CCC2)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N2O/c1-2-15(12-5-3-6-13(9-12)18(19,20)21)23-16(24)22-14-10-17(11-14)7-4-8-17/h1,3,5-6,9,14-15H,4,7-8,10-11H2,(H2,22,23,24) |
| InChIKey | WGSABVXYPXAFGE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|