C23H25ClN4O3 — CID 16652060
butyl 4-[[1-(4-chlorophenyl)-5-propyltriazole-4-carbonyl]amino]benzoate (PubChem CID 16652060) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is butyl 4-[[1-(4-chlorophenyl)-5-propyltriazole-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(4-chlorophenyl)-5-propyltriazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16652060 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | butyl 4-[[1-(4-chlorophenyl)-5-propyltriazole-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2nnn(-c3ccc(Cl)cc3)c2CCC)cc1 |
| InChI | InChI=1S/C23H25ClN4O3/c1-3-5-15-31-23(30)16-7-11-18(12-8-16)25-22(29)21-20(6-4-2)28(27-26-21)19-13-9-17(24)10-14-19/h7-14H,3-6,15H2,1-2H3,(H,25,29) |
| InChIKey | ASSLIHUBCABNOA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|