C5H5BrIN3 — CID 166520825
4-bromo-3-iodopyridine-2,6-diamine (PubChem CID 166520825) has the molecular formula C5H5BrIN3 and a molecular weight of 313.92 g/mol. Its IUPAC name is 4-bromo-3-iodopyridine-2,6-diamine.
| Compound Name | 4-bromo-3-iodopyridine-2,6-diamine |
|---|---|
| PubChem CID | 166520825 |
| Molecular Formula | C5H5BrIN3 |
| Molecular Weight | 313.92 g/mol |
| Exact Mass | 312.87 |
| IUPAC Name | 4-bromo-3-iodopyridine-2,6-diamine |
| SMILES | Nc1cc(Br)c(I)c(N)n1 |
| InChI | InChI=1S/C5H5BrIN3/c6-2-1-3(8)10-5(9)4(2)7/h1H,(H4,8,9,10) |
| InChIKey | FWBYPVCQCVMAJI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.92 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|