C22H14F5N3O3 — CID 166526250
5,6-difluoro-N-methyl-N-[(1R)-4,8,9-trifluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1H-indole-2-carboxamide (PubChem CID 166526250) has the molecular formula C22H14F5N3O3 and a molecular weight of 463.36 g/mol. Its IUPAC name is 5,6-difluoro-N-methyl-N-[(1R)-4,8,9-trifluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1H-indole-2-carboxamide.
| Compound Name | 5,6-difluoro-N-methyl-N-[(1R)-4,8,9-trifluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166526250 |
| Molecular Formula | C22H14F5N3O3 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 5,6-difluoro-N-methyl-N-[(1R)-4,8,9-trifluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2cc(F)c(F)cc2[nH]1)[C@H]1COC(F)c2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C22H14F5N3O3/c1-30(22(32)16-3-8-2-11(23)14(26)6-15(8)28-16)17-7-33-20(27)19-18(17)9-4-12(24)13(25)5-10(9)21(31)29-19/h2-6,17,20,28H,7H2,1H3,(H,29,31)/t17-,20?/m0/s1 |
| InChIKey | JMQAWSZMXYZIAI-DIMJTDRSSA-N |
| XLogP | 4.38 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |