C23H17F4N3O4 — CID 166526756
N-[(1R)-8,9-difluoro-4-methoxy-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide (PubChem CID 166526756) has the molecular formula C23H17F4N3O4 and a molecular weight of 475.40 g/mol. Its IUPAC name is N-[(1R)-8,9-difluoro-4-methoxy-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1R)-8,9-difluoro-4-methoxy-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166526756 |
| Molecular Formula | C23H17F4N3O4 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-[(1R)-8,9-difluoro-4-methoxy-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide |
| SMILES | COC1OC[C@H](N(C)C(=O)c2cc3cc(F)c(F)cc3[nH]2)c2c1[nH]c(=O)c1cc(F)c(F)cc21 |
| InChI | InChI=1S/C23H17F4N3O4/c1-30(22(32)17-4-9-3-12(24)15(27)7-16(9)28-17)18-8-34-23(33-2)20-19(18)10-5-13(25)14(26)6-11(10)21(31)29-20/h3-7,18,23,28H,8H2,1-2H3,(H,29,31)/t18-,23?/m0/s1 |
| InChIKey | CQERWPPCBUTHNE-XNUZUHMRSA-N |
| XLogP | 4.05 |
| TPSA | 87.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |