C23H17F4N3O3 — CID 166526915
N-[(1S,4R)-8,9-difluoro-4-hydroxy-6-oxo-2,3,4,5-tetrahydro-1H-phenanthridin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide (PubChem CID 166526915) has the molecular formula C23H17F4N3O3 and a molecular weight of 459.40 g/mol. Its IUPAC name is N-[(1S,4R)-8,9-difluoro-4-hydroxy-6-oxo-2,3,4,5-tetrahydro-1H-phenanthridin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1S,4R)-8,9-difluoro-4-hydroxy-6-oxo-2,3,4,5-tetrahydro-1H-phenanthridin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166526915 |
| Molecular Formula | C23H17F4N3O3 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-[(1S,4R)-8,9-difluoro-4-hydroxy-6-oxo-2,3,4,5-tetrahydro-1H-phenanthridin-1-yl]-5,6-difluoro-N-methyl-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2cc(F)c(F)cc2[nH]1)[C@H]1CC[C@@H](O)c2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C23H17F4N3O3/c1-30(23(33)17-5-9-4-12(24)15(27)8-16(9)28-17)18-2-3-19(31)21-20(18)10-6-13(25)14(26)7-11(10)22(32)29-21/h4-8,18-19,28,31H,2-3H2,1H3,(H,29,32)/t18-,19+/m0/s1 |
| InChIKey | IGYURYZDEHBAJJ-RBUKOAKNSA-N |
| XLogP | 4.21 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |