C16H19N5O6 — CID 166530816
[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methanimidoyloxolan-2-yl]methoxycarbonyloxymethyl acetate (PubChem CID 166530816) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is [(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methanimidoyloxolan-2-yl]methoxycarbonyloxymethyl acetate.
| Compound Name | [(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methanimidoyloxolan-2-yl]methoxycarbonyloxymethyl acetate |
|---|---|
| PubChem CID | 166530816 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methanimidoyloxolan-2-yl]methoxycarbonyloxymethyl acetate |
| SMILES | [H]/N=C/[C@]1(c2ccc3c(N)ncnn23)CCC(COC(=O)OCOC(C)=O)O1 |
| InChI | InChI=1S/C16H19N5O6/c1-10(22)25-9-26-15(23)24-6-11-4-5-16(7-17,27-11)13-3-2-12-14(18)19-8-20-21(12)13/h2-3,7-8,11,17H,4-6,9H2,1H3,(H2,18,19,20)/b17-7+/t11?,16-/m0/s1 |
| InChIKey | AVUDCYWFJPBWMX-RSRGEURXSA-N |
| XLogP | 1.01 |
| TPSA | 151.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|