C21H34N2O2 — CID 166534879
ethane;methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate (PubChem CID 166534879) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is ethane;methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate.
| Compound Name | ethane;methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166534879 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | ethane;methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate |
| SMILES | CC.COC(=O)C1CCN(C(C)(C)c2ccc(C3CNC3)cc2)CC1 |
| InChI | InChI=1S/C19H28N2O2.C2H6/c1-19(2,21-10-8-15(9-11-21)18(22)23-3)17-6-4-14(5-7-17)16-12-20-13-16;1-2/h4-7,15-16,20H,8-13H2,1-3H3;1-2H3 |
| InChIKey | ZRVBQUKSZNDVPW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |