C19H28N2O2 — CID 166534880
methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate (PubChem CID 166534880) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166534880 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | methyl 1-[2-[4-(azetidin-3-yl)phenyl]propan-2-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(C)(C)c2ccc(C3CNC3)cc2)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-19(2,21-10-8-15(9-11-21)18(22)23-3)17-6-4-14(5-7-17)16-12-20-13-16/h4-7,15-16,20H,8-13H2,1-3H3 |
| InChIKey | KFXLPNXBWIYINS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |