C10H13ClFN — CID 166539502
(2Z,4Z,6E)-6-(chloromethylidene)-2-fluoro-N-methylocta-2,4,7-trien-3-amine (PubChem CID 166539502) has the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. Its IUPAC name is (2Z,4Z,6E)-6-(chloromethylidene)-2-fluoro-N-methylocta-2,4,7-trien-3-amine.
| Compound Name | (2Z,4Z,6E)-6-(chloromethylidene)-2-fluoro-N-methylocta-2,4,7-trien-3-amine |
|---|---|
| PubChem CID | 166539502 |
| Molecular Formula | C10H13ClFN |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (2Z,4Z,6E)-6-(chloromethylidene)-2-fluoro-N-methylocta-2,4,7-trien-3-amine |
| SMILES | C=CC(/C=C\C(NC)=C(/C)F)=C\Cl |
| InChI | InChI=1S/C10H13ClFN/c1-4-9(7-11)5-6-10(13-3)8(2)12/h4-7,13H,1H2,2-3H3/b6-5-,9-7+,10-8- |
| InChIKey | BIYPKYWPSQHGSC-PQIPLARDSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|