C26H24N6O2 — CID 166539996
1-[4-[4-[(6-phenoxy-3-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166539996) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-[4-[4-[(6-phenoxy-3-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[(6-phenoxy-3-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166539996 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-[4-[4-[(6-phenoxy-3-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ccc3ncnc(Nc4ccc(Oc5ccccc5)nc4)c3c2)CC1 |
| InChI | InChI=1S/C26H24N6O2/c1-2-25(33)32-14-12-31(13-15-32)20-9-10-23-22(16-20)26(29-18-28-23)30-19-8-11-24(27-17-19)34-21-6-4-3-5-7-21/h2-11,16-18H,1,12-15H2,(H,28,29,30) |
| InChIKey | HYPYAWDFBXDJBX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|