C26H23ClN6O2 — CID 166538571
1-[4-[4-[(4-chloro-5-phenoxy-2-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166538571) has the molecular formula C26H23ClN6O2 and a molecular weight of 486.96 g/mol. Its IUPAC name is 1-[4-[4-[(4-chloro-5-phenoxy-2-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[(4-chloro-5-phenoxy-2-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166538571 |
| Molecular Formula | C26H23ClN6O2 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-[4-[4-[(4-chloro-5-phenoxy-2-pyridinyl)amino]quinazolin-6-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ccc3ncnc(Nc4cc(Cl)c(Oc5ccccc5)cn4)c3c2)CC1 |
| InChI | InChI=1S/C26H23ClN6O2/c1-2-25(34)33-12-10-32(11-13-33)18-8-9-22-20(14-18)26(30-17-29-22)31-24-15-21(27)23(16-28-24)35-19-6-4-3-5-7-19/h2-9,14-17H,1,10-13H2,(H,28,29,30,31) |
| InChIKey | BNURCVMHNQCPOM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|