C11H20N2O — CID 166542601
2-ethyl-5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane (PubChem CID 166542601) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-ethyl-5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane.
| Compound Name | 2-ethyl-5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 166542601 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-ethyl-5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane |
| SMILES | CCN1CC2(CCCN2C2COC2)C1 |
| InChI | InChI=1S/C11H20N2O/c1-2-12-8-11(9-12)4-3-5-13(11)10-6-14-7-10/h10H,2-9H2,1H3 |
| InChIKey | GWBUECPTHABDHH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |