C9H16N2O — CID 166543486
5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane (PubChem CID 166543486) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane.
| Compound Name | 5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 166543486 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octane |
| SMILES | C1CN(C2COC2)C2(C1)CNC2 |
| InChI | InChI=1S/C9H16N2O/c1-2-9(6-10-7-9)11(3-1)8-4-12-5-8/h8,10H,1-7H2 |
| InChIKey | APLUGIKKIQBHPF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |