C9H18N2O — CID 155822342
5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane (PubChem CID 155822342) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane.
| Compound Name | 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 155822342 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane |
| SMILES | COCCN1CCCC12CNC2 |
| InChI | InChI=1S/C9H18N2O/c1-12-6-5-11-4-2-3-9(11)7-10-8-9/h10H,2-8H2,1H3 |
| InChIKey | SBGOUEPNOLRXHW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |