C13H8ClFN4O3 — CID 166544249
6-(2-chloro-3-fluoro-4-nitrophenoxy)-3-methylimidazo[4,5-b]pyridine (PubChem CID 166544249) has the molecular formula C13H8ClFN4O3 and a molecular weight of 322.68 g/mol. Its IUPAC name is 6-(2-chloro-3-fluoro-4-nitrophenoxy)-3-methylimidazo[4,5-b]pyridine.
| Compound Name | 6-(2-chloro-3-fluoro-4-nitrophenoxy)-3-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 166544249 |
| Molecular Formula | C13H8ClFN4O3 |
| Molecular Weight | 322.68 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-(2-chloro-3-fluoro-4-nitrophenoxy)-3-methylimidazo[4,5-b]pyridine |
| SMILES | Cn1cnc2cc(Oc3ccc([N+](=O)[O-])c(F)c3Cl)cnc21 |
| InChI | InChI=1S/C13H8ClFN4O3/c1-18-6-17-8-4-7(5-16-13(8)18)22-10-3-2-9(19(20)21)12(15)11(10)14/h2-6H,1H3 |
| InChIKey | QNDPOBCUCXFSIK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|