C15H18BrNOS — CID 16654588
2-(3-bromophenyl)-3-cyclohexyl-1,3-thiazolidin-4-one (PubChem CID 16654588) has the molecular formula C15H18BrNOS and a molecular weight of 340.29 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-cyclohexyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-bromophenyl)-3-cyclohexyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16654588 |
| Molecular Formula | C15H18BrNOS |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-(3-bromophenyl)-3-cyclohexyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccc(Br)c2)N1C1CCCCC1 |
| InChI | InChI=1S/C15H18BrNOS/c16-12-6-4-5-11(9-12)15-17(14(18)10-19-15)13-7-2-1-3-8-13/h4-6,9,13,15H,1-3,7-8,10H2 |
| InChIKey | HZKBQWJUJRBRJK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |