C8H12N2 — CID 166546504
N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine (PubChem CID 166546504) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine.
| Compound Name | N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine |
|---|---|
| PubChem CID | 166546504 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine |
| SMILES | C=C/N=C/C1=C(C)CCN1 |
| InChI | InChI=1S/C8H12N2/c1-3-9-6-8-7(2)4-5-10-8/h3,6,10H,1,4-5H2,2H3/b9-6+ |
| InChIKey | WSVLQLKKRCMLSX-RMKNXTFCSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|