C14H21N5 — CID 166552122
ethane;5-[3-(ethylamino)prop-1-ynyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 166552122) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is ethane;5-[3-(ethylamino)prop-1-ynyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | ethane;5-[3-(ethylamino)prop-1-ynyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166552122 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | ethane;5-[3-(ethylamino)prop-1-ynyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC.CCNCC#Cc1cn(C)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H15N5.C2H6/c1-3-14-6-4-5-9-7-17(2)12-10(9)11(13)15-8-16-12;1-2/h7-8,14H,3,6H2,1-2H3,(H2,13,15,16);1-2H3 |
| InChIKey | OYRMIDQSGSHLTJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|