C21H16N5+ — CID 161490335
7-methyl-5-[2-(6H-pyrido[2,1-a]isoindol-5-ium-3-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 161490335) has the molecular formula C21H16N5+ and a molecular weight of 338.39 g/mol. Its IUPAC name is 7-methyl-5-[2-(6H-pyrido[2,1-a]isoindol-5-ium-3-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-5-[2-(6H-pyrido[2,1-a]isoindol-5-ium-3-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 161490335 |
| Molecular Formula | C21H16N5+ |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 7-methyl-5-[2-(6H-pyrido[2,1-a]isoindol-5-ium-3-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1cc(C#Cc2ccc3[n+](c2)Cc2ccccc2-3)c2c(N)ncnc21 |
| InChI | InChI=1S/C21H16N5/c1-25-11-16(19-20(22)23-13-24-21(19)25)8-6-14-7-9-18-17-5-3-2-4-15(17)12-26(18)10-14/h2-5,7,9-11,13H,12H2,1H3,(H2,22,23,24)/q+1 |
| InChIKey | NDFQBOBODUWKSL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|