C20H16N6O+2 — CID 159304661
2-amino-5-[2-(7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethynyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 159304661) has the molecular formula C20H16N6O+2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-amino-5-[2-(7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethynyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-[2-(7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethynyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 159304661 |
| Molecular Formula | C20H16N6O+2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-amino-5-[2-(7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethynyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cn1cc(C#Cc2ccc3[n+](c2)C[n+]2ccccc2-3)c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C20H14N6O/c1-24-11-14(17-18(24)22-20(21)23-19(17)27)7-5-13-6-8-16-15-4-2-3-9-25(15)12-26(16)10-13/h2-4,6,8-11H,12H2,1H3,(H-,21,23,27)/p+2 |
| InChIKey | GQJWVIWBLCOBIJ-UHFFFAOYSA-P |
| XLogP | 0.30 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|