C6H11ClN2S — CID 166552937
5-chloro-3-ethyl-1,2,4-thiadiazole;ethane (PubChem CID 166552937) has the molecular formula C6H11ClN2S and a molecular weight of 178.69 g/mol. Its IUPAC name is 5-chloro-3-ethyl-1,2,4-thiadiazole;ethane.
| Compound Name | 5-chloro-3-ethyl-1,2,4-thiadiazole;ethane |
|---|---|
| PubChem CID | 166552937 |
| Molecular Formula | C6H11ClN2S |
| Molecular Weight | 178.69 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 5-chloro-3-ethyl-1,2,4-thiadiazole;ethane |
| SMILES | CC.CCc1nsc(Cl)n1 |
| InChI | InChI=1S/C4H5ClN2S.C2H6/c1-2-3-6-4(5)8-7-3;1-2/h2H2,1H3;1-2H3 |
| InChIKey | FGYAIMBZWPDXCB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |