C11H16O6 — CID 16655573
(1S,5S,7R,9S,10R,11S)-4,9,10-trihydroxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one (PubChem CID 16655573) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is (1S,5S,7R,9S,10R,11S)-4,9,10-trihydroxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one.
| Compound Name | (1S,5S,7R,9S,10R,11S)-4,9,10-trihydroxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one |
|---|---|
| PubChem CID | 16655573 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (1S,5S,7R,9S,10R,11S)-4,9,10-trihydroxy-4,11-dimethyl-3,6-dioxatricyclo[5.3.1.01,5]undecan-2-one |
| SMILES | C[C@@H]1[C@H]2C[C@H](O)[C@H](O)[C@@]13C(=O)OC(C)(O)[C@H]3O2 |
| InChI | InChI=1S/C11H16O6/c1-4-6-3-5(12)7(13)11(4)8(16-6)10(2,15)17-9(11)14/h4-8,12-13,15H,3H2,1-2H3/t4-,5+,6-,7+,8-,10?,11+/m1/s1 |
| InChIKey | OHIPAYYEGXXFIX-FZELGWIWSA-N |
| XLogP | -1.23 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |