C20H25NO5S — CID 16655816
N-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-4-methyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide (PubChem CID 16655816) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-4-methyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-4-methyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16655816 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-phenylmethoxypropyl]-4-methyl-N-[[(2S)-oxiran-2-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C[C@@H](O)COCc2ccccc2)C[C@H]2CO2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-16-7-9-20(10-8-16)27(23,24)21(12-19-15-26-19)11-18(22)14-25-13-17-5-3-2-4-6-17/h2-10,18-19,22H,11-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | TXHFYWMHTWVLPV-MOPGFXCFSA-N |
| XLogP | 1.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|