C23H24FNO4S — CID 101497565
N-benzyl-2-fluoro-N-(2-hydroxy-3-phenylmethoxypropyl)benzenesulfonamide (PubChem CID 101497565) has the molecular formula C23H24FNO4S and a molecular weight of 429.51 g/mol. Its IUPAC name is N-benzyl-2-fluoro-N-(2-hydroxy-3-phenylmethoxypropyl)benzenesulfonamide.
| Compound Name | N-benzyl-2-fluoro-N-(2-hydroxy-3-phenylmethoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 101497565 |
| Molecular Formula | C23H24FNO4S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-benzyl-2-fluoro-N-(2-hydroxy-3-phenylmethoxypropyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1F)N(Cc1ccccc1)CC(O)COCc1ccccc1 |
| InChI | InChI=1S/C23H24FNO4S/c24-22-13-7-8-14-23(22)30(27,28)25(15-19-9-3-1-4-10-19)16-21(26)18-29-17-20-11-5-2-6-12-20/h1-14,21,26H,15-18H2 |
| InChIKey | XPWQJZSMHFMRRO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |