C12H15ClFNO3S — CID 166564435
4-(5-chloro-2-fluoro-3-pyridinyl)-2,2-dimethyl-1,1-dioxothian-4-ol (PubChem CID 166564435) has the molecular formula C12H15ClFNO3S and a molecular weight of 307.77 g/mol. Its IUPAC name is 4-(5-chloro-2-fluoro-3-pyridinyl)-2,2-dimethyl-1,1-dioxothian-4-ol.
| Compound Name | 4-(5-chloro-2-fluoro-3-pyridinyl)-2,2-dimethyl-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 166564435 |
| Molecular Formula | C12H15ClFNO3S |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-(5-chloro-2-fluoro-3-pyridinyl)-2,2-dimethyl-1,1-dioxothian-4-ol |
| SMILES | CC1(C)CC(O)(c2cc(Cl)cnc2F)CCS1(=O)=O |
| InChI | InChI=1S/C12H15ClFNO3S/c1-11(2)7-12(16,3-4-19(11,17)18)9-5-8(13)6-15-10(9)14/h5-6,16H,3-4,7H2,1-2H3 |
| InChIKey | FXZGKAGVVRCXLT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|