C17H31N6O4PS — CID 166564723
(2R,3S,5R)-2-(2,6-diamino-3,6-dihydropurin-9-yl)-4-[hydroxy(2-methylpropyl)phosphinothioyl]oxy-5-(2-methylpropyl)oxolan-3-ol (PubChem CID 166564723) has the molecular formula C17H31N6O4PS and a molecular weight of 446.51 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,6-diamino-3,6-dihydropurin-9-yl)-4-[hydroxy(2-methylpropyl)phosphinothioyl]oxy-5-(2-methylpropyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(2,6-diamino-3,6-dihydropurin-9-yl)-4-[hydroxy(2-methylpropyl)phosphinothioyl]oxy-5-(2-methylpropyl)oxolan-3-ol |
|---|---|
| PubChem CID | 166564723 |
| Molecular Formula | C17H31N6O4PS |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2R,3S,5R)-2-(2,6-diamino-3,6-dihydropurin-9-yl)-4-[hydroxy(2-methylpropyl)phosphinothioyl]oxy-5-(2-methylpropyl)oxolan-3-ol |
| SMILES | CC(C)C[C@H]1O[C@@H](n2cnc3c2NC(N)=NC3N)[C@@H](O)C1OP(O)(=S)CC(C)C |
| InChI | InChI=1S/C17H31N6O4PS/c1-8(2)5-10-13(27-28(25,29)6-9(3)4)12(24)16(26-10)23-7-20-11-14(18)21-17(19)22-15(11)23/h7-10,12-14,16,24H,5-6,18H2,1-4H3,(H,25,29)(H3,19,21,22)/t10-,12+,13?,14?,16-,28?/m1/s1 |
| InChIKey | WHGMAESTVRAUPX-ZOLIQCBGSA-N |
| XLogP | 1.23 |
| TPSA | 153.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|