C10H15ClN5O7P — CID 163199935
[(2R,3R,5R)-5-(2-amino-6-chloro-3,6-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163199935) has the molecular formula C10H15ClN5O7P and a molecular weight of 383.69 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2-amino-6-chloro-3,6-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-(2-amino-6-chloro-3,6-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163199935 |
| Molecular Formula | C10H15ClN5O7P |
| Molecular Weight | 383.69 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | [(2R,3R,5R)-5-(2-amino-6-chloro-3,6-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC1=NC(Cl)c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@H](O)C3O)c2N1 |
| InChI | InChI=1S/C10H15ClN5O7P/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(18)5(17)3(23-9)1-22-24(19,20)21/h2-3,5-7,9,17-18H,1H2,(H3,12,14,15)(H2,19,20,21)/t3-,5+,6?,7?,9-/m1/s1 |
| InChIKey | OSFJHNCZKKLFDQ-OIJZIIHISA-N |
| XLogP | -1.41 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.69 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|