C18H32N5O4P — CID 118176094
(2R,3R,4S,5R)-2-(2-amino-6-butoxy-3,6-dihydropurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol (PubChem CID 118176094) has the molecular formula C18H32N5O4P and a molecular weight of 413.46 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2-amino-6-butoxy-3,6-dihydropurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2-amino-6-butoxy-3,6-dihydropurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 118176094 |
| Molecular Formula | C18H32N5O4P |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2-amino-6-butoxy-3,6-dihydropurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
| SMILES | C=P(C)(C)CC[C@H]1O[C@@H](n2cnc3c2NC(N)=NC3OCCCC)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32N5O4P/c1-5-6-8-26-16-12-15(21-18(19)22-16)23(10-20-12)17-14(25)13(24)11(27-17)7-9-28(2,3)4/h10-11,13-14,16-17,24-25H,2,5-9H2,1,3-4H3,(H3,19,21,22)/t11-,13-,14-,16?,17-/m1/s1 |
| InChIKey | WRVUQLHMBLMXRG-GYVRUONCSA-N |
| XLogP | 1.16 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|