C22H28ClN7O4 — CID 166573213
[(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(3-ethyloxetane-3-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate (PubChem CID 166573213) has the molecular formula C22H28ClN7O4 and a molecular weight of 489.96 g/mol. Its IUPAC name is [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(3-ethyloxetane-3-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate.
| Compound Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(3-ethyloxetane-3-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate |
|---|---|
| PubChem CID | 166573213 |
| Molecular Formula | C22H28ClN7O4 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(3-ethyloxetane-3-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate |
| SMILES | CCC1(C(=O)Nc2ccc(/C(N)=C(\NC(=O)O[C@H](C)c3cccnc3Cl)N(C)N)nc2)COC1 |
| InChI | InChI=1S/C22H28ClN7O4/c1-4-22(11-33-12-22)20(31)28-14-7-8-16(27-10-14)17(24)19(30(3)25)29-21(32)34-13(2)15-6-5-9-26-18(15)23/h5-10,13H,4,11-12,24-25H2,1-3H3,(H,28,31)(H,29,32)/b19-17-/t13-/m1/s1 |
| InChIKey | UKUZMGNIFCTZTI-JPWUFHEYSA-N |
| XLogP | 2.37 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|