C15H18ClN5O3S — CID 16658245
2-[4-chloro-7-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-1-yl]guanidine (PubChem CID 16658245) has the molecular formula C15H18ClN5O3S and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-[4-chloro-7-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-1-yl]guanidine.
| Compound Name | 2-[4-chloro-7-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-1-yl]guanidine |
|---|---|
| PubChem CID | 16658245 |
| Molecular Formula | C15H18ClN5O3S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[4-chloro-7-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-1-yl]guanidine |
| SMILES | NC(N)=Nc1ncc(Cl)c2ccc(S(=O)(=O)N3CCC[C@@H]3CO)cc12 |
| InChI | InChI=1S/C15H18ClN5O3S/c16-13-7-19-14(20-15(17)18)12-6-10(3-4-11(12)13)25(23,24)21-5-1-2-9(21)8-22/h3-4,6-7,9,22H,1-2,5,8H2,(H4,17,18,19,20)/t9-/m1/s1 |
| InChIKey | OQMRNIRRUCXMGT-SECBINFHSA-N |
| XLogP | 0.94 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|