C20H18F3N — CID 16658265
1-benzyl-2,4-dimethyl-3-phenyl-5-(trifluoromethyl)pyrrole (PubChem CID 16658265) has the molecular formula C20H18F3N and a molecular weight of 329.37 g/mol. Its IUPAC name is 1-benzyl-2,4-dimethyl-3-phenyl-5-(trifluoromethyl)pyrrole.
| Compound Name | 1-benzyl-2,4-dimethyl-3-phenyl-5-(trifluoromethyl)pyrrole |
|---|---|
| PubChem CID | 16658265 |
| Molecular Formula | C20H18F3N |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-benzyl-2,4-dimethyl-3-phenyl-5-(trifluoromethyl)pyrrole |
| SMILES | Cc1c(-c2ccccc2)c(C)n(Cc2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C20H18F3N/c1-14-18(17-11-7-4-8-12-17)15(2)24(19(14)20(21,22)23)13-16-9-5-3-6-10-16/h3-12H,13H2,1-2H3 |
| InChIKey | HQHNCZAGJWSTCG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |