C16H9ClN4O — CID 166582820
2-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)-1,3-benzoxazole (PubChem CID 166582820) has the molecular formula C16H9ClN4O and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 166582820 |
| Molecular Formula | C16H9ClN4O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)-1,3-benzoxazole |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C16H9ClN4O/c17-16-20-13(10-6-2-1-3-7-10)19-14(21-16)15-18-11-8-4-5-9-12(11)22-15/h1-9H |
| InChIKey | PPFBCQJJKNURFJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |