C27H17N5O — CID 70830037
2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]-1,3-benzoxazole (PubChem CID 70830037) has the molecular formula C27H17N5O and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]-1,3-benzoxazole.
| Compound Name | 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70830037 |
| Molecular Formula | C27H17N5O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc5ccccc5o4)nc3)n2)cc1 |
| InChI | InChI=1S/C27H17N5O/c1-3-9-18(10-4-1)24-30-25(19-11-5-2-6-12-19)32-26(31-24)20-15-16-22(28-17-20)27-29-21-13-7-8-14-23(21)33-27/h1-17H |
| InChIKey | UZYAONNSCLFJJX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |