C21H20Cl3N3OS2 — CID 166592404
3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(2,5-dichlorothiophen-3-yl)sulfonimidoyl]propan-1-amine (PubChem CID 166592404) has the molecular formula C21H20Cl3N3OS2 and a molecular weight of 500.90 g/mol. Its IUPAC name is 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(2,5-dichlorothiophen-3-yl)sulfonimidoyl]propan-1-amine.
| Compound Name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(2,5-dichlorothiophen-3-yl)sulfonimidoyl]propan-1-amine |
|---|---|
| PubChem CID | 166592404 |
| Molecular Formula | C21H20Cl3N3OS2 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(2,5-dichlorothiophen-3-yl)sulfonimidoyl]propan-1-amine |
| SMILES | [H]N=S(=O)(NCCCN1c2ccccc2CCc2ccc(Cl)cc21)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C21H20Cl3N3OS2/c22-16-9-8-15-7-6-14-4-1-2-5-17(14)27(18(15)12-16)11-3-10-26-30(25,28)19-13-20(23)29-21(19)24/h1-2,4-5,8-9,12-13H,3,6-7,10-11H2,(H2,25,26,28) |
| InChIKey | MBJHUTJDAPGKIR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|