C24H26ClN3O3S2 — CID 166592688
3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(4-methylsulfonylphenyl)sulfonimidoyl]propan-1-amine (PubChem CID 166592688) has the molecular formula C24H26ClN3O3S2 and a molecular weight of 504.08 g/mol. Its IUPAC name is 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(4-methylsulfonylphenyl)sulfonimidoyl]propan-1-amine.
| Compound Name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(4-methylsulfonylphenyl)sulfonimidoyl]propan-1-amine |
|---|---|
| PubChem CID | 166592688 |
| Molecular Formula | C24H26ClN3O3S2 |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-[(4-methylsulfonylphenyl)sulfonimidoyl]propan-1-amine |
| SMILES | [H]N=S(=O)(NCCCN1c2ccccc2CCc2ccc(Cl)cc21)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H26ClN3O3S2/c1-32(29,30)21-11-13-22(14-12-21)33(26,31)27-15-4-16-28-23-6-3-2-5-18(23)7-8-19-9-10-20(25)17-24(19)28/h2-3,5-6,9-14,17H,4,7-8,15-16H2,1H3,(H2,26,27,31) |
| InChIKey | PBRXZCLYNYXXAZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|