C11H10F4N2O3 — CID 16659478
(2S,4S)-3-(2-fluoro-4-nitrophenyl)-4-methyl-2-(trifluoromethyl)-1,3-oxazolidine (PubChem CID 16659478) has the molecular formula C11H10F4N2O3 and a molecular weight of 294.20 g/mol. Its IUPAC name is (2S,4S)-3-(2-fluoro-4-nitrophenyl)-4-methyl-2-(trifluoromethyl)-1,3-oxazolidine.
| Compound Name | (2S,4S)-3-(2-fluoro-4-nitrophenyl)-4-methyl-2-(trifluoromethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 16659478 |
| Molecular Formula | C11H10F4N2O3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (2S,4S)-3-(2-fluoro-4-nitrophenyl)-4-methyl-2-(trifluoromethyl)-1,3-oxazolidine |
| SMILES | C[C@H]1CO[C@@H](C(F)(F)F)N1c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H10F4N2O3/c1-6-5-20-10(11(13,14)15)16(6)9-3-2-7(17(18)19)4-8(9)12/h2-4,6,10H,5H2,1H3/t6-,10-/m0/s1 |
| InChIKey | FBZKUSJXJRAVHJ-WKEGUHRASA-N |
| XLogP | 2.85 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|