C23H21NO5S — CID 166597857
2-[(6-ethoxy-11,11-dimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-9-yl)methylsulfanyl]benzoic acid (PubChem CID 166597857) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[(6-ethoxy-11,11-dimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-9-yl)methylsulfanyl]benzoic acid.
| Compound Name | 2-[(6-ethoxy-11,11-dimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-9-yl)methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 166597857 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[(6-ethoxy-11,11-dimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-9-yl)methylsulfanyl]benzoic acid |
| SMILES | CCOc1cc2c3c(c1)C(CSc1ccccc1C(=O)O)=CC(C)(C)N3C(=O)C2=O |
| InChI | InChI=1S/C23H21NO5S/c1-4-29-14-9-16-13(12-30-18-8-6-5-7-15(18)22(27)28)11-23(2,3)24-19(16)17(10-14)20(25)21(24)26/h5-11H,4,12H2,1-3H3,(H,27,28) |
| InChIKey | MKCOBJXIIGELDN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|