C19H20N4O5 — CID 166599590
formic acid;morpholin-4-yl-[4-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethoxy)phenyl]methanone (PubChem CID 166599590) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is formic acid;morpholin-4-yl-[4-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethoxy)phenyl]methanone.
| Compound Name | formic acid;morpholin-4-yl-[4-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 166599590 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | formic acid;morpholin-4-yl-[4-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2cccc3ncnn23)cc1)N1CCOCC1.O=CO |
| InChI | InChI=1S/C18H18N4O3.CH2O2/c23-18(21-8-10-24-11-9-21)14-4-6-16(7-5-14)25-12-15-2-1-3-17-19-13-20-22(15)17;2-1-3/h1-7,13H,8-12H2;1H,(H,2,3) |
| InChIKey | XBCYGSRXSBWVRJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|