C14H18N4OS — CID 166602336
N-tert-butyl-1-thieno[2,3-d]pyrimidin-4-ylazetidine-3-carboxamide (PubChem CID 166602336) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-tert-butyl-1-thieno[2,3-d]pyrimidin-4-ylazetidine-3-carboxamide.
| Compound Name | N-tert-butyl-1-thieno[2,3-d]pyrimidin-4-ylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 166602336 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-tert-butyl-1-thieno[2,3-d]pyrimidin-4-ylazetidine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CN(c2ncnc3sccc23)C1 |
| InChI | InChI=1S/C14H18N4OS/c1-14(2,3)17-12(19)9-6-18(7-9)11-10-4-5-20-13(10)16-8-15-11/h4-5,8-9H,6-7H2,1-3H3,(H,17,19) |
| InChIKey | CMXAQHKLRGXOLT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |