C19H27N3O3 — CID 16660551
1-[4-(2-ethylpiperidin-1-yl)butyl]-8-hydroxyquinazoline-2,4-dione (PubChem CID 16660551) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[4-(2-ethylpiperidin-1-yl)butyl]-8-hydroxyquinazoline-2,4-dione.
| Compound Name | 1-[4-(2-ethylpiperidin-1-yl)butyl]-8-hydroxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 16660551 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-[4-(2-ethylpiperidin-1-yl)butyl]-8-hydroxyquinazoline-2,4-dione |
| SMILES | CCC1CCCCN1CCCCn1c(=O)[nH]c(=O)c2cccc(O)c21 |
| InChI | InChI=1S/C19H27N3O3/c1-2-14-8-3-4-11-21(14)12-5-6-13-22-17-15(9-7-10-16(17)23)18(24)20-19(22)25/h7,9-10,14,23H,2-6,8,11-13H2,1H3,(H,20,24,25) |
| InChIKey | PGRROKQGIOCUTA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|