C30H21N5O3S — CID 166606946
2-(1,3-diphenylpyrazol-4-yl)-5-[(3-nitrophenyl)methylidene]-3-pyridin-2-yl-1,3-thiazolidin-4-one (PubChem CID 166606946) has the molecular formula C30H21N5O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)-5-[(3-nitrophenyl)methylidene]-3-pyridin-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)-5-[(3-nitrophenyl)methylidene]-3-pyridin-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 166606946 |
| Molecular Formula | C30H21N5O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)-5-[(3-nitrophenyl)methylidene]-3-pyridin-2-yl-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cccc([N+](=O)[O-])c2)SC(c2cn(-c3ccccc3)nc2-c2ccccc2)N1c1ccccn1 |
| InChI | InChI=1S/C30H21N5O3S/c36-29-26(19-21-10-9-15-24(18-21)35(37)38)39-30(34(29)27-16-7-8-17-31-27)25-20-33(23-13-5-2-6-14-23)32-28(25)22-11-3-1-4-12-22/h1-20,30H |
| InChIKey | LXDDGTSFBITKNR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|