C27H42N2O12S — CID 166609425
[5-acetamido-3,4-diacetyloxy-6-(6-aminohexoxy)oxan-2-yl]methyl acetate;4-methylbenzenesulfonic acid (PubChem CID 166609425) has the molecular formula C27H42N2O12S and a molecular weight of 618.70 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-(6-aminohexoxy)oxan-2-yl]methyl acetate;4-methylbenzenesulfonic acid.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-(6-aminohexoxy)oxan-2-yl]methyl acetate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 166609425 |
| Molecular Formula | C27H42N2O12S |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-(6-aminohexoxy)oxan-2-yl]methyl acetate;4-methylbenzenesulfonic acid |
| SMILES | CC(=O)NC1C(OCCCCCCN)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H34N2O9.C7H8O3S/c1-12(23)22-17-19(30-15(4)26)18(29-14(3)25)16(11-28-13(2)24)31-20(17)27-10-8-6-5-7-9-21;1-6-2-4-7(5-3-6)11(8,9)10/h16-20H,5-11,21H2,1-4H3,(H,22,23);2-5H,1H3,(H,8,9,10) |
| InChIKey | JUWGQUVRUMWBGX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 206.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|