C20H30ClN3O3 — CID 166613961
2-[(2S,5R)-5-(acetamidomethyl)-1-methylpyrrolidin-2-yl]-N-[3-(3-chlorophenoxy)propyl]-N-methylacetamide (PubChem CID 166613961) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 2-[(2S,5R)-5-(acetamidomethyl)-1-methylpyrrolidin-2-yl]-N-[3-(3-chlorophenoxy)propyl]-N-methylacetamide.
| Compound Name | 2-[(2S,5R)-5-(acetamidomethyl)-1-methylpyrrolidin-2-yl]-N-[3-(3-chlorophenoxy)propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 166613961 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[(2S,5R)-5-(acetamidomethyl)-1-methylpyrrolidin-2-yl]-N-[3-(3-chlorophenoxy)propyl]-N-methylacetamide |
| SMILES | CC(=O)NC[C@H]1CC[C@@H](CC(=O)N(C)CCCOc2cccc(Cl)c2)N1C |
| InChI | InChI=1S/C20H30ClN3O3/c1-15(25)22-14-18-9-8-17(24(18)3)13-20(26)23(2)10-5-11-27-19-7-4-6-16(21)12-19/h4,6-7,12,17-18H,5,8-11,13-14H2,1-3H3,(H,22,25)/t17-,18+/m0/s1 |
| InChIKey | CCLSAJTXVJKQCR-ZWKOTPCHSA-N |
| XLogP | 2.56 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|