C22H33N5O3 — CID 166621207
N-[(3S,5R)-5-hydroxy-1-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]piperidin-3-yl]-5-pyridin-3-ylpentanamide (PubChem CID 166621207) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[(3S,5R)-5-hydroxy-1-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]piperidin-3-yl]-5-pyridin-3-ylpentanamide.
| Compound Name | N-[(3S,5R)-5-hydroxy-1-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]piperidin-3-yl]-5-pyridin-3-ylpentanamide |
|---|---|
| PubChem CID | 166621207 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | N-[(3S,5R)-5-hydroxy-1-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]piperidin-3-yl]-5-pyridin-3-ylpentanamide |
| SMILES | COCCn1cncc1CN1C[C@H](O)C[C@H](NC(=O)CCCCc2cccnc2)C1 |
| InChI | InChI=1S/C22H33N5O3/c1-30-10-9-27-17-24-13-20(27)15-26-14-19(11-21(28)16-26)25-22(29)7-3-2-5-18-6-4-8-23-12-18/h4,6,8,12-13,17,19,21,28H,2-3,5,7,9-11,14-16H2,1H3,(H,25,29)/t19-,21+/m0/s1 |
| InChIKey | MGBGMQDUACWJJV-PZJWPPBQSA-N |
| XLogP | 1.39 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|